EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H3O2PS |
| Net Charge | 0 |
| Average Mass | 98.063 |
| Monoisotopic Mass | 97.95914 |
| SMILES | [H]P(O)(O)=S |
| InChI | InChI=1S/H3O2PS/c1-3(2)4/h3H,(H2,1,2,4) |
| InChIKey | FUWGSUOSJRCEIV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | inorganic acid A Brønsted acid derived from one or more inorganic compounds. Inorganic acids (also known as mineral acids) form hydrons and conjugate base ions when dissolved in water. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phosphonothioic O,O-acid (CHEBI:50151) is a phosphorus oxoacid (CHEBI:33457) |
| Incoming Relation(s) |
| phosphonothioyl group (CHEBI:32413) is substituent group from phosphonothioic O,O-acid (CHEBI:50151) |
| IUPAC Name |
|---|
| hydrido(dihydroxido)(sulfanediido)phosphorus |