EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H33NO |
| Net Charge | 0 |
| Average Mass | 303.490 |
| Monoisotopic Mass | 303.25621 |
| SMILES | C[C@@H](Cc1ccc(C(C)(C)C)cc1)CN1C[C@@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C20H33NO/c1-15(12-21-13-16(2)22-17(3)14-21)11-18-7-9-19(10-8-18)20(4,5)6/h7-10,15-17H,11-14H2,1-6H3/t15-,16-,17+/m0/s1 |
| InChIKey | RYAUSSKQMZRMAI-YESZJQIVSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-fenpropimorph (CHEBI:50146) is a 4-[3-(4-tert-butylphenyl)-2-methylpropyl]-2,6-dimethylmorpholine (CHEBI:50148) |
| (S)-fenpropimorph (CHEBI:50146) is enantiomer of (R)-fenpropimorph (CHEBI:50147) |
| Incoming Relation(s) |
| fenpropimorph (CHEBI:50145) has part (S)-fenpropimorph (CHEBI:50146) |
| (R)-fenpropimorph (CHEBI:50147) is enantiomer of (S)-fenpropimorph (CHEBI:50146) |
| IUPAC Name |
|---|
| (2R,6S)-4-[(2S)-3-(4-tert-butylphenyl)-2-methylpropyl]-2,6-dimethylmorpholine |
| Synonyms | Source |
|---|---|
| (S)-cis-fenpropimorph | ChEBI |
| (S)-(−)-fenpropimorph | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5340026 | Reaxys |