EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H3O3.Na |
| Net Charge | 0 |
| Average Mass | 110.044 |
| Monoisotopic Mass | 109.99799 |
| SMILES | CC(=O)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C3H4O3.Na/c1-2(4)3(5)6;/h1H3,(H,5,6);/q;+1/p-1 |
| InChIKey | DAEPDZWVDSPTHF-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| Application: | anti-asthmatic agent Any compound that has anti-asthmatic effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sodium pyruvate (CHEBI:50144) has part pyruvate (CHEBI:15361) |
| sodium pyruvate (CHEBI:50144) has role anti-asthmatic agent (CHEBI:65023) |
| sodium pyruvate (CHEBI:50144) has role antiviral agent (CHEBI:22587) |
| sodium pyruvate (CHEBI:50144) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium 2-oxopropanoate |
| Synonyms | Source |
|---|---|
| Natriumpyruvat | ChEBI |
| pyruvate sodium | ChEMBL |
| Pyruvate sodium | ChEMBL |
| pyruvic acid, sodium salt | ChemIDplus |
| Sodium 2-oxo-propionate | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3568341 | Beilstein |
| Gmelin:97013 | Gmelin |
| CAS:113-24-6 | ChemIDplus |
| Citations |
|---|