EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:5013 - fenuron
| Formula | C9H12N2O |
| Net Charge | 0 |
| Average Mass | 164.208 |
| Monoisotopic Mass | 164.09496 |
| SMILES | CN(C)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C9H12N2O/c1-11(2)9(12)10-8-6-4-3-5-7-8/h3-7H,1-2H3,(H,10,12) |
| InChIKey | XXOYNJXVWVNOOJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fenuron (CHEBI:5013) has role agrochemical (CHEBI:33286) |
| fenuron (CHEBI:5013) has role environmental contaminant (CHEBI:78298) |
| fenuron (CHEBI:5013) has role herbicide (CHEBI:24527) |
| fenuron (CHEBI:5013) has role photosystem-II inhibitor (CHEBI:26089) |
| fenuron (CHEBI:5013) has role xenobiotic (CHEBI:35703) |
| fenuron (CHEBI:5013) is a 3-(3,4-substituted-phenyl)-1,1-dimethylurea (CHEBI:157693) |
| IUPAC Name |
|---|
| 1,1-dimethyl-3-phenylurea |
| Synonyms | Source |
|---|---|
| N,N-dimethyl-N'-phenylurea | IUPAC |
| PDU | PPDB |
| 3-phenyl-1,1-dimethylurea | NIST Chemistry WebBook |
| 1-phenyl-3,3-dimethylurea | NIST Chemistry WebBook |
| N-Phenyl-N',N'-dimethylurea | ChemIDplus |
| Brand Names | Source |
|---|---|
| Dozer | ChEBI |
| Falisilvan | ChemIDplus |
| Fenidin | ChemIDplus |
| Dibar | ChemIDplus |
| Dybar | ChemIDplus |
| Croptex Ruby | ChemIDplus |
| UniProt Name | Source |
|---|---|
| fenuron | UniProt |
| Citations |
|---|