EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H40N7O18P3S |
| Net Charge | 0 |
| Average Mass | 899.659 |
| Monoisotopic Mass | 899.13634 |
| SMILES | CC(C)(COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O)[C@@H](O)C(=O)NCCC(=O)NCCSC(=O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C29H40N7O18P3S/c1-29(2,23(40)26(41)32-9-8-18(37)31-10-11-58-28(42)20(38)16-6-4-3-5-7-16)13-51-57(48,49)54-56(46,47)50-12-17-22(53-55(43,44)45)21(39)27(52-17)36-15-35-19-24(30)33-14-34-25(19)36/h3-7,14-15,17,21-23,27,39-40H,8-13H2,1-2H3,(H,31,37)(H,32,41)(H,46,47)(H,48,49)(H2,30,33,34)(H2,43,44,45)/t17-,21-,22-,23+,27-/m1/s1 |
| InChIKey | FISPFQWSJIRGHD-SVHODSNWSA-N |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phenylglyoxylyl-CoA (CHEBI:50117) has functional parent coenzyme A (CHEBI:15346) |
| phenylglyoxylyl-CoA (CHEBI:50117) has functional parent phenylglyoxylic acid (CHEBI:18280) |
| phenylglyoxylyl-CoA (CHEBI:50117) is a acyl-CoA (CHEBI:17984) |
| phenylglyoxylyl-CoA (CHEBI:50117) is conjugate acid of phenylglyoxylyl-CoA(4−) (CHEBI:58811) |
| Incoming Relation(s) |
| phenylglyoxylyl-CoA(4−) (CHEBI:58811) is conjugate base of phenylglyoxylyl-CoA (CHEBI:50117) |
| IUPAC Name |
|---|
| 3'-phosphoadenosine 5'-{3-[(3R)-3-hydroxy-2,2-dimethyl-4-oxo-4-({3-oxo-3-[(2-{[oxo(phenyl)acetyl]sulfanyl}ethyl)amino]propyl}amino)butyl] dihydrogen diphosphate} |
| Synonyms | Source |
|---|---|
| 2-ketophenylacetyl-CoA | ChEBI |
| 2-ketophenylacetyl-coenzyme A | ChEBI |
| 2-oxo-2-phenylacetyl-CoA | ChEBI |
| 2-oxo-2-phenylacetyl-coenzyme A | ChEBI |
| benzoyl-formyl-CoA | ChEBI |
| benzoyl-formyl coenzyme A | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C15524 | KEGG COMPOUND |
| Citations |
|---|