EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:50099 - (4-chloro-2-methylphenoxy)acetic acid
| Formula | C9H9ClO3 |
| Net Charge | 0 |
| Average Mass | 200.621 |
| Monoisotopic Mass | 200.02402 |
| SMILES | Cc1cc(Cl)ccc1OCC(=O)O |
| InChI | InChI=1S/C9H9ClO3/c1-6-4-7(10)2-3-8(6)13-5-9(11)12/h2-4H,5H2,1H3,(H,11,12) |
| InChIKey | WHKUVVPPKQRRBV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | synthetic auxin A synthetic compound exhibiting auxin activity. |
| Application: | phenoxy herbicide Any member of the class of herbicides whose members contain a phenoxy or substituted phenoxy group. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4-chloro-2-methylphenoxy)acetic acid (CHEBI:50099) has role environmental contaminant (CHEBI:78298) |
| (4-chloro-2-methylphenoxy)acetic acid (CHEBI:50099) has role phenoxy herbicide (CHEBI:60575) |
| (4-chloro-2-methylphenoxy)acetic acid (CHEBI:50099) has role synthetic auxin (CHEBI:26841) |
| (4-chloro-2-methylphenoxy)acetic acid (CHEBI:50099) is a chlorophenoxyacetic acid (CHEBI:23152) |
| (4-chloro-2-methylphenoxy)acetic acid (CHEBI:50099) is a monochlorobenzenes (CHEBI:83403) |
| (4-chloro-2-methylphenoxy)acetic acid (CHEBI:50099) is conjugate acid of (4-chloro-2-methylphenoxy)acetate (CHEBI:231609) |
| Incoming Relation(s) |
| (4-chloro-2-methylphenoxy)acetate (CHEBI:231609) is conjugate base of (4-chloro-2-methylphenoxy)acetic acid (CHEBI:50099) |
| IUPAC Name |
|---|
| (4-chloro-2-methylphenoxy)acetic acid |
| Synonyms | Source |
|---|---|
| 2,4-MCPA | ChemIDplus |
| 2-Methyl-4-chlorophenoxyacetic acid | ChemIDplus |
| MCPA | ChemIDplus |
| 2-Methyl-4-chlorphenoxyessigsäure | ChemIDplus |
| ((4-chloro-o-tolyl)oxy)acetic acid | ChemIDplus |
| [(4-Chloro-o-tolyl)oxy]acetic acid | NIST Chemistry WebBook |
| Brand Name | Source |
|---|---|
| Agroxone | ChemIDplus |
| Citations |
|---|