EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H24N5O8P |
| Net Charge | 0 |
| Average Mass | 469.391 |
| Monoisotopic Mass | 469.13625 |
| SMILES | CCCC(=O)Nc1ncnc2c1ncn2[C@@H]1O[C@@H]2COP(=O)(O)O[C@H]2[C@H]1OC(=O)CCC |
| InChI | InChI=1S/C18H24N5O8P/c1-3-5-11(24)22-16-13-17(20-8-19-16)23(9-21-13)18-15(30-12(25)6-4-2)14-10(29-18)7-28-32(26,27)31-14/h8-10,14-15,18H,3-7H2,1-2H3,(H,26,27)(H,19,20,22,24)/t10-,14-,15-,18-/m1/s1 |
| InChIKey | CJGYSWNGNKCJSB-YVLZZHOMSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | agonist Substance which binds to cell receptors normally responding to naturally occurring substances and which produces a response of its own. |
| Applications: | vasodilator agent A drug used to cause dilation of the blood vessels. cardiotonic drug A drug that has a strengthening effect on the heart or that can increase cardiac output. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bucladesine (CHEBI:50095) has functional parent 3',5'-cyclic AMP (CHEBI:17489) |
| bucladesine (CHEBI:50095) has role agonist (CHEBI:48705) |
| bucladesine (CHEBI:50095) has role cardiotonic drug (CHEBI:38147) |
| bucladesine (CHEBI:50095) has role vasodilator agent (CHEBI:35620) |
| bucladesine (CHEBI:50095) is a 3',5'-cyclic purine nucleotide (CHEBI:19834) |
| bucladesine (CHEBI:50095) is a butanamides (CHEBI:22965) |
| bucladesine (CHEBI:50095) is a butyrate ester (CHEBI:50477) |
| IUPAC Names |
|---|
| (4aR,6R,7R,7aR)-6-(6-butanamido-9H-purin-9-yl)-2-hydroxy-2-oxidotetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-7-yl butanoate |
| 6-N-butanoyl-2'-O-butanoyladenosine 3',5'-(hydrogen phosphate) |
| INNs | Source |
|---|---|
| bucladesina | ChemIDplus |
| bucladesine | ChemIDplus |
| bucladesinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 3',5'-cyclic AMP dibutyrate | ChemIDplus |
| Bt2cAMP | SUBMITTER |
| dbcAMP | DrugCentral |
| dibutyryl-3',5'-AMP | ChemIDplus |
| dibutyryl 3',5'-cyclic AMP | ChemIDplus |
| dibutyryladenosine 3',5'-cyclic monophosphate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 415 | DrugCentral |
| Bucladesine | Wikipedia |
| D07546 | KEGG DRUG |
| LSM-1926 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:871714 | Reaxys |
| CAS:362-74-3 | KEGG DRUG |
| CAS:362-74-3 | ChemIDplus |
| Citations |
|---|