EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16N4O7S |
| Net Charge | 0 |
| Average Mass | 336.326 |
| Monoisotopic Mass | 336.07397 |
| SMILES | N[C@@H](CCC(=O)N[C@@H](CSN=O)C(=O)NCC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H16N4O7S/c11-5(10(19)20)1-2-7(15)13-6(4-22-14-21)9(18)12-3-8(16)17/h5-6H,1-4,11H2,(H,12,18)(H,13,15)(H,16,17)(H,19,20)/t5-,6-/m0/s1 |
| InChIKey | HYHSBSXUHZOYLX-WDSKDSINSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | nitric oxide donor An agent, with unique chemical structure and biochemical requirements, which generates nitric oxide. |
| Biological Role: | signalling molecule A molecular messenger in which the molecule is specifically involved in transmitting information between cells. Such molecules are released from the cell sending the signal, cross over the gap between cells by diffusion, and interact with specific receptors in another cell, triggering a response in that cell by activating a series of enzyme controlled reactions which lead to changes inside the cell. |
| Applications: | platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. bronchodilator agent An agent that causes an increase in the expansion of a bronchus or bronchial tubes. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-nitrosoglutathione (CHEBI:50091) has role bronchodilator agent (CHEBI:35523) |
| S-nitrosoglutathione (CHEBI:50091) has role nitric oxide donor (CHEBI:50566) |
| S-nitrosoglutathione (CHEBI:50091) has role platelet aggregation inhibitor (CHEBI:50427) |
| S-nitrosoglutathione (CHEBI:50091) has role signalling molecule (CHEBI:62488) |
| S-nitrosoglutathione (CHEBI:50091) is a glutathione derivative (CHEBI:24337) |
| S-nitrosoglutathione (CHEBI:50091) is a nitrosothio compound (CHEBI:145545) |
| S-nitrosoglutathione (CHEBI:50091) is conjugate acid of S-nitrosoglutathione(2−) (CHEBI:43056) |
| Incoming Relation(s) |
| S-nitrosoglutathione(2−) (CHEBI:43056) is conjugate base of S-nitrosoglutathione (CHEBI:50091) |
| IUPAC Name |
|---|
| L-γ-glutamyl-S-nitroso-L-cysteinylglycine |
| Synonyms | Source |
|---|---|
| N-(N-L-γ-glutamyl-S-nitroso-L-cysteinyl)glycine | ChemIDplus |
| glutathione thionitrite | ChemIDplus |
| GSNO | ChemIDplus |
| nitrosoglutathione | ChemIDplus |
| SNOG | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 94647 | ChemSpider |
| FDB023390 | FooDB |
| HMDB0004645 | HMDB |
| S-Nitrosoglutathione | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3566211 | Beilstein |
| CAS:57564-91-7 | ChemIDplus |
| Citations |
|---|