EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:5009 - fenoxycarb
| Formula | C17H19NO4 |
| Net Charge | 0 |
| Average Mass | 301.342 |
| Monoisotopic Mass | 301.13141 |
| SMILES | CCOC(=O)NCCOc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C17H19NO4/c1-2-20-17(19)18-12-13-21-14-8-10-16(11-9-14)22-15-6-4-3-5-7-15/h3-11H,2,12-13H2,1H3,(H,18,19) |
| InChIKey | HJUFTIJOISQSKQ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Applications: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fenoxycarb (CHEBI:5009) has functional parent 4-phenoxyphenol (CHEBI:39264) |
| fenoxycarb (CHEBI:5009) has role environmental contaminant (CHEBI:78298) |
| fenoxycarb (CHEBI:5009) has role insecticide (CHEBI:24852) |
| fenoxycarb (CHEBI:5009) has role juvenile hormone mimic (CHEBI:24942) |
| fenoxycarb (CHEBI:5009) has role xenobiotic (CHEBI:35703) |
| fenoxycarb (CHEBI:5009) is a aromatic ether (CHEBI:35618) |
| fenoxycarb (CHEBI:5009) is a carbamate ester (CHEBI:23003) |
| IUPAC Name |
|---|
| ethyl [2-(4-phenoxyphenoxy)ethyl]carbamate |
| Synonyms | Source |
|---|---|
| Fenoxycarb | KEGG COMPOUND |
| (2-(4-phenoxyphenoxy)ethyl)carbamic acid ethyl ester | ChemIDplus |
| N-(2-(p-phenoxyphenoxy)ethyl)carbamic acid | ChemIDplus |
| ethyl (2-(p-phenoxyphenoxy)ethyl)carbamate | ChemIDplus |
| O-ethyl N-[2-(4-phenoxyphenoxy)ethyl]carbamate | ChEBI |
| Brand Name | Source |
|---|---|
| Insegar | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| C11078 | KEGG COMPOUND |
| US4215135 | Patent |
| fenoxycarb | Alan Wood's Pesticides |
| CN103651557 | Patent |
| Fenoxycarb | Wikipedia |
| 304 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6932817 | Reaxys |
| CAS:72490-01-8 | KEGG COMPOUND |
| CAS:72490-01-8 | ChemIDplus |
| CAS:79127-80-3 | NIST Chemistry WebBook |
| Citations |
|---|