EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16O |
| Net Charge | 0 |
| Average Mass | 152.237 |
| Monoisotopic Mass | 152.12012 |
| SMILES | CC1C(=O)CC2(C(C)C)CC12 |
| InChI | InChI=1S/C10H16O/c1-6(2)10-4-8(10)7(3)9(11)5-10/h6-8H,4-5H2,1-3H3 |
| InChIKey | USMNOWBWPHYOEA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thujone (CHEBI:50040) has role plant metabolite (CHEBI:76924) |
| thujone (CHEBI:50040) is a cyclic terpene ketone (CHEBI:36130) |
| thujone (CHEBI:50040) is a thujane monoterpenoid (CHEBI:50041) |
| Incoming Relation(s) |
| α-thujone (CHEBI:50042) is a thujone (CHEBI:50040) |
| β-thujone (CHEBI:50044) is a thujone (CHEBI:50040) |
| IUPAC Name |
|---|
| thujan-3-one |
| Synonyms | Source |
|---|---|
| 3-thujanone | NIST Chemistry WebBook |
| 4-methyl-1-(propan-2-yl)bicyclo[3.1.0]hexan-3-one | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| HMDB0041631 | HMDB |
| Thujone | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1860055 | Beilstein |
| CAS:1125-12-8 | NIST Chemistry WebBook |