EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16 |
| Net Charge | 0 |
| Average Mass | 136.238 |
| Monoisotopic Mass | 136.12520 |
| SMILES | [H][C@]12C[C@@]1(C(C)C)CC=C2C |
| InChI | InChI=1S/C10H16/c1-7(2)10-5-4-8(3)9(10)6-10/h4,7,9H,5-6H2,1-3H3/t9-,10-/m1/s1 |
| InChIKey | KQAZVFVOEIRWHN-NXEZZACHSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-α-thujene (CHEBI:50033) is a α-thujene (CHEBI:50031) |
| (−)-α-thujene (CHEBI:50033) is enantiomer of (+)-α-thujene (CHEBI:50032) |
| Incoming Relation(s) |
| (+)-α-thujene (CHEBI:50032) is enantiomer of (−)-α-thujene (CHEBI:50033) |
| IUPAC Name |
|---|
| (1R,5S)-2-methyl-5-(propan-2-yl)bicyclo[3.1.0]hex-2-ene |
| Synonym | Source |
|---|---|
| (1R,5S)-5-isopropyl-2-methylbicyclo[3.1.0]hex-2-ene | IUPAC |
| Registry Numbers | Sources |
|---|---|
| CAS:3917-48-4 | ChemIDplus |