EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16ClNO3.CH4O3S |
| Net Charge | 0 |
| Average Mass | 401.868 |
| Monoisotopic Mass | 401.06999 |
| SMILES | CS(=O)(=O)O.Oc1ccc(C2CNCCc3c2cc(O)c(O)c3Cl)cc1 |
| InChI | InChI=1S/C16H16ClNO3.CH4O3S/c17-15-11-5-6-18-8-13(9-1-3-10(19)4-2-9)12(11)7-14(20)16(15)21;1-5(2,3)4/h1-4,7,13,18-21H,5-6,8H2;1H3,(H,2,3,4) |
| InChIKey | CVKUMNRCIJMVAR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | renoprotective agent Any compound that is able to prevent damage to the kidneys. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fenoldopam mesylate (CHEBI:5003) has role antihypertensive agent (CHEBI:35674) |
| Fenoldopam mesylate (CHEBI:5003) has role renoprotective agent (CHEBI:231911) |
| Fenoldopam mesylate (CHEBI:5003) is a benzazepine (CHEBI:35676) |
| Synonyms | Source |
|---|---|
| Corlopam (TN) | KEGG COMPOUND |
| Fendolopam mesylate | ChEMBL |
| Fenoldopam mesylate | KEGG COMPOUND |
| Fenoldopam methanesulfonate | ChEMBL |
| NSC-759860 | ChEMBL |
| SK-82526-J | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D00613 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:67227-57-0 | KEGG COMPOUND |
| Citations |
|---|