EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:50027 - sabinene
| Formula | C10H16 |
| Net Charge | 0 |
| Average Mass | 136.238 |
| Monoisotopic Mass | 136.12520 |
| SMILES | C=C1CCC2(C(C)C)CC12 |
| InChI | InChI=1S/C10H16/c1-7(2)10-5-4-8(3)9(10)6-10/h7,9H,3-6H2,1-2H3 |
| InChIKey | NDVASEGYNIMXJL-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sabinene (CHEBI:50027) has role plant metabolite (CHEBI:76924) |
| sabinene (CHEBI:50027) is a thujene (CHEBI:50030) |
| Incoming Relation(s) |
| (+)-sabinene (CHEBI:50029) is a sabinene (CHEBI:50027) |
| (−)-sabinene (CHEBI:50028) is a sabinene (CHEBI:50027) |
| IUPAC Names |
|---|
| 4-methylidene-1-(propan-2-yl)bicyclo[3.1.0]hexane |
| thuj-4(10)-ene |
| Synonyms | Source |
|---|---|
| 1-isopropyl-4-methylenebicyclo[3.1.0]hexane | NIST Chemistry WebBook |
| 4(10)-thujene | NIST Chemistry WebBook |
| 4-methylene-1-(1-methylethyl)bicyclo[3.1.0]hexane | NIST Chemistry WebBook |
| Sabinen | KEGG COMPOUND |
| Sabinen | ChemIDplus |
| UniProt Name | Source |
|---|---|
| sabinene | UniProt |
| Citations |
|---|