EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16 |
| Net Charge | 0 |
| Average Mass | 136.238 |
| Monoisotopic Mass | 136.12520 |
| SMILES | C=C1CC[C@@H]2C[C@H]1C2(C)C |
| InChI | InChI=1S/C10H16/c1-7-4-5-8-6-9(7)10(8,2)3/h8-9H,1,4-6H2,2-3H3/t8-,9-/m1/s1 |
| InChIKey | WTARULDDTDQWMU-RKDXNWHRSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-β-pinene (CHEBI:50026) is a β-pinene (CHEBI:50025) |
| (+)-β-pinene (CHEBI:50026) is enantiomer of (−)-β-pinene (CHEBI:28359) |
| Incoming Relation(s) |
| (−)-β-pinene (CHEBI:28359) is enantiomer of (+)-β-pinene (CHEBI:50026) |
| IUPAC Names |
|---|
| (1R,5R)-6,6-dimethyl-2-methylidenebicyclo[3.1.1]heptane |
| (1R,5R)-pin-2(10)-ene |
| UniProt Name | Source |
|---|---|
| (1R,5R)-β-pinene | UniProt |