EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8AsNO2 |
| Net Charge | 0 |
| Average Mass | 201.057 |
| Monoisotopic Mass | 200.97710 |
| SMILES | Nc1cccc([As](O)O)c1 |
| InChI | InChI=1S/C6H8AsNO2/c8-6-3-1-2-5(4-6)7(9)10/h1-4,9-10H,8H2 |
| InChIKey | KACQPIDTGIOEQD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | inorganic acid A Brønsted acid derived from one or more inorganic compounds. Inorganic acids (also known as mineral acids) form hydrons and conjugate base ions when dissolved in water. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| m-aminophenylarsonous acid (CHEBI:50023) is a aminophenylarsonous acid (CHEBI:50020) |
| IUPAC Name |
|---|
| (3-aminophenyl)arsonous acid |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2829711 | Beilstein |