EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16ClNO3 |
| Net Charge | 0 |
| Average Mass | 305.761 |
| Monoisotopic Mass | 305.08187 |
| SMILES | Oc1ccc(C2CNCCc3c2cc(O)c(O)c3Cl)cc1 |
| InChI | InChI=1S/C16H16ClNO3/c17-15-11-5-6-18-8-13(9-1-3-10(19)4-2-9)12(11)7-14(20)16(15)21/h1-4,7,13,18-21H,5-6,8H2 |
| InChIKey | TVURRHSHRRELCG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. dopamine agonist A drug that binds to and activates dopamine receptors. |
| Applications: | alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. renoprotective agent Any compound that is able to prevent damage to the kidneys. vasodilator agent A drug used to cause dilation of the blood vessels. dopamine agonist A drug that binds to and activates dopamine receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fenoldopam (CHEBI:5002) has role antihypertensive agent (CHEBI:35674) |
| fenoldopam (CHEBI:5002) has role cardiovascular drug (CHEBI:35554) |
| fenoldopam (CHEBI:5002) has role dopamine agonist (CHEBI:51065) |
| fenoldopam (CHEBI:5002) has role dopaminergic antagonist (CHEBI:48561) |
| fenoldopam (CHEBI:5002) has role renoprotective agent (CHEBI:231911) |
| fenoldopam (CHEBI:5002) has role vasodilator agent (CHEBI:35620) |
| fenoldopam (CHEBI:5002) has role α-adrenergic agonist (CHEBI:35569) |
| fenoldopam (CHEBI:5002) is a benzazepine (CHEBI:35676) |
| IUPAC Name |
|---|
| 6-chloro-1-(4-hydroxyphenyl)-2,3,4,5-tetrahydro-1H-3-benzazepine-7,8-diol |
| INNs | Source |
|---|---|
| fenoldopam | ChemIDplus |
| fénoldopam | ChEBI |
| fenoldopamum | ChemIDplus |
| Synonyms | Source |
|---|---|
| Carlacor | ChEMBL |
| SK-82526 | ChEMBL |
| SK&F-82526 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:67227-56-9 | ChemIDplus |
| Citations |
|---|