EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16ClNO3 |
| Net Charge | 0 |
| Average Mass | 305.761 |
| Monoisotopic Mass | 305.08187 |
| SMILES | Oc1ccc(C2CNCCc3c2cc(O)c(O)c3Cl)cc1 |
| InChI | InChI=1S/C16H16ClNO3/c17-15-11-5-6-18-8-13(9-1-3-10(19)4-2-9)12(11)7-14(20)16(15)21/h1-4,7,13,18-21H,5-6,8H2 |
| InChIKey | TVURRHSHRRELCG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | dopamine agonist A drug that binds to and activates dopamine receptors. alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. |
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. dopamine agonist A drug that binds to and activates dopamine receptors. alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fenoldopam (CHEBI:5002) has role antihypertensive agent (CHEBI:35674) |
| fenoldopam (CHEBI:5002) has role dopamine agonist (CHEBI:51065) |
| fenoldopam (CHEBI:5002) has role dopaminergic antagonist (CHEBI:48561) |
| fenoldopam (CHEBI:5002) has role vasodilator agent (CHEBI:35620) |
| fenoldopam (CHEBI:5002) has role α-adrenergic agonist (CHEBI:35569) |
| fenoldopam (CHEBI:5002) is a benzazepine (CHEBI:35676) |
| IUPAC Name |
|---|
| 6-chloro-1-(4-hydroxyphenyl)-2,3,4,5-tetrahydro-1H-3-benzazepine-7,8-diol |
| INNs | Source |
|---|---|
| fenoldopam | ChemIDplus |
| fénoldopam | ChEBI |
| fenoldopamum | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:67227-56-9 | ChemIDplus |