EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14O |
| Net Charge | 0 |
| Average Mass | 150.221 |
| Monoisotopic Mass | 150.10447 |
| SMILES | C=C(C)[C@H]1CC=C(C)C(=O)C1 |
| InChI | InChI=1S/C10H14O/c1-7(2)9-5-4-8(3)10(11)6-9/h4,9H,1,5-6H2,2-3H3/t9-/m0/s1 |
| InChIKey | ULDHMXUKGWMISQ-VIFPVBQESA-N |
| Roles Classification |
|---|
| Biological Roles: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-carvone (CHEBI:15399) is a carvone (CHEBI:38265) |
| (+)-carvone (CHEBI:15399) is enantiomer of (−)-carvone (CHEBI:15400) |
| Incoming Relation(s) |
| (−)-carvone (CHEBI:15400) is enantiomer of (+)-carvone (CHEBI:15399) |
| IUPAC Names |
|---|
| (4S)-p-mentha-1(6),8-dien-2-one |
| (5S)-2-methyl-5-(prop-1-en-2-yl)cyclohex-2-en-1-one |
| Synonyms | Source |
|---|---|
| (+)-(4S)-carvone | ChEBI |
| (5S)-2-methyl-5-(1-methylethenyl)-2-cyclohexen-1-one | ChemIDplus |
| Carvol | KEGG COMPOUND |
| (+)-Carvone | KEGG COMPOUND |
| Carvone | KEGG COMPOUND |
| d-(+)-carvone | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| (S)-carvone | UniProt |
| Citations |
|---|