EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:38265 - carvone
| Formula | C10H14O |
| Net Charge | 0 |
| Average Mass | 150.221 |
| Monoisotopic Mass | 150.10447 |
| SMILES | C=C(C)C1CC=C(C)C(=O)C1 |
| InChI | InChI=1S/C10H14O/c1-7(2)9-5-4-8(3)10(11)6-9/h4,9H,1,5-6H2,2-3H3 |
| InChIKey | ULDHMXUKGWMISQ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carvone (CHEBI:38265) has role allergen (CHEBI:50904) |
| carvone (CHEBI:38265) is a botanical anti-fungal agent (CHEBI:86494) |
| carvone (CHEBI:38265) is a carvones (CHEBI:23048) |
| Incoming Relation(s) |
| (+)-carvone (CHEBI:15399) is a carvone (CHEBI:38265) |
| (−)-carvone (CHEBI:15400) is a carvone (CHEBI:38265) |
| IUPAC Names |
|---|
| 2-methyl-5-(prop-1-en-2-yl)cyclohex-2-en-1-one |
| p-mentha-1(6),8-dien-2-one |
| Synonyms | Source |
|---|---|
| 1-carvone | ChEBI |
| 2-methyl-5-(1-methyl-1-ethenyl)-2-cyclohexen-1-one | ChEBI |
| 2-methyl-5-(1-methylethenyl)-2-cyclohexen-1-one | ChEBI |
| 2-methyl-5-isopropenyl-2-cyclohexenone | NIST Chemistry WebBook |
| 2-methyl-5-(prop-1-en-2-yl)cyclohex-2-enone | ChEBI |
| 5-isopropenyl-2-methylcyclohex-2-en-1-one | ChEBI |
| Citations |
|---|