EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H14N2O4 |
| Net Charge | 0 |
| Average Mass | 238.243 |
| Monoisotopic Mass | 238.09536 |
| SMILES | NC(=O)OCC(COC(N)=O)c1ccccc1 |
| InChI | InChI=1S/C11H14N2O4/c12-10(14)16-6-9(7-17-11(13)15)8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H2,12,14)(H2,13,15) |
| InChIKey | WKGXYQFOCVYPAC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | anticonvulsant A drug used to prevent seizures or reduce their severity. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| felbamate (CHEBI:4995) has role anticonvulsant (CHEBI:35623) |
| felbamate (CHEBI:4995) has role neuroprotective agent (CHEBI:63726) |
| felbamate (CHEBI:4995) is a carbamate ester (CHEBI:23003) |
| IUPAC Name |
|---|
| 2-phenylpropane-1,3-diyl dicarbamate |
| INNs | Source |
|---|---|
| felbamate | ChemIDplus |
| felbamato | ChemIDplus |
| felbamatum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-phenyl-1,3-propanediol dicarbamate | ChEMBL |
| carbamic acid 2-phenyltrimethylene ester | ChEBI |
| Carbamic acid 3-carbamoyloxy-2-phenyl-propyl ester | ChEMBL |
| Felbamate | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3345236 | Reaxys |
| CAS:25451-15-4 | KEGG COMPOUND |
| CAS:25451-15-4 | NIST Chemistry WebBook |
| CAS:25451-15-4 | ChemIDplus |
| Citations |
|---|