EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H14N2O4 |
| Net Charge | 0 |
| Average Mass | 238.243 |
| Monoisotopic Mass | 238.09536 |
| SMILES | NC(=O)OCC(COC(N)=O)c1ccccc1 |
| InChI | InChI=1S/C11H14N2O4/c12-10(14)16-6-9(7-17-11(13)15)8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H2,12,14)(H2,13,15) |
| InChIKey | WKGXYQFOCVYPAC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. anticonvulsant A drug used to prevent seizures or reduce their severity. anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| felbamate (CHEBI:4995) has role anti-anaemic agent (CHEBI:75835) |
| felbamate (CHEBI:4995) has role anticonvulsant (CHEBI:35623) |
| felbamate (CHEBI:4995) has role antipsychotic agent (CHEBI:35476) |
| felbamate (CHEBI:4995) has role neuroprotective agent (CHEBI:63726) |
| felbamate (CHEBI:4995) is a carbamate ester (CHEBI:23003) |
| IUPAC Name |
|---|
| 2-phenylpropane-1,3-diyl dicarbamate |
| INNs | Source |
|---|---|
| felbamate | ChemIDplus |
| felbamato | ChemIDplus |
| felbamatum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-phenyl-1,3-propanediol dicarbamate | ChEMBL |
| ADD-03055 | ChEMBL |
| carbamic acid 2-phenyltrimethylene ester | ChEBI |
| Carbamic acid 3-carbamoyloxy-2-phenyl-propyl ester | ChEMBL |
| Felbamate | KEGG COMPOUND |
| NSC-759866 | ChEMBL |
| Brand Name | Source |
|---|---|
| Taloxa | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3345236 | Reaxys |
| CAS:25451-15-4 | NIST Chemistry WebBook |
| CAS:25451-15-4 | ChemIDplus |
| CAS:25451-15-4 | KEGG COMPOUND |
| Citations |
|---|