EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H21F7N4O3 |
| Net Charge | 0 |
| Average Mass | 534.432 |
| Monoisotopic Mass | 534.15019 |
| SMILES | C[C@@H](O[C@H]1OCCN(Cc2nnc(=O)n2)[C@H]1c1ccc(F)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H21F7N4O3/c1-12(14-8-15(22(25,26)27)10-16(9-14)23(28,29)30)37-20-19(13-2-4-17(24)5-3-13)34(6-7-36-20)11-18-31-21(35)33-32-18/h2-5,8-10,12,19-20H,6-7,11H2,1H3,(H2,31,32,33,35)/t12-,19+,20-/m1/s1 |
| InChIKey | ATALOFNDEOCMKK-OITMNORJSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | neurokinin-1 receptor antagonist An antagonist at the neurokinin-1 receptor. substance P receptor antagonist An antagonist at the substance P receptor. |
| Applications: | peripheral nervous system drug A drug that acts principally at one or more sites within the peripheral neuroeffector systems, the autonomic system, and motor nerve-skeletal system. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aprepitant (CHEBI:499361) has role antidepressant (CHEBI:35469) |
| aprepitant (CHEBI:499361) has role antiemetic (CHEBI:50919) |
| aprepitant (CHEBI:499361) has role neurokinin-1 receptor antagonist (CHEBI:55350) |
| aprepitant (CHEBI:499361) has role peripheral nervous system drug (CHEBI:49110) |
| aprepitant (CHEBI:499361) has role substance P receptor antagonist (CHEBI:55351) |
| aprepitant (CHEBI:499361) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| aprepitant (CHEBI:499361) is a cyclic acetal (CHEBI:59770) |
| aprepitant (CHEBI:499361) is a morpholines (CHEBI:38785) |
| aprepitant (CHEBI:499361) is a triazoles (CHEBI:35727) |
| IUPAC Name |
|---|
| 5-{[(2R,3S)-2-{(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy}-3-(4-fluorophenyl)morpholin-4-yl]methyl}-2,4-dihydro-3H-1,2,4-triazol-3-one |
| INNs | Source |
|---|---|
| aprepitant | WHO MedNet |
| aprepitant | KEGG DRUG |
| aprépitant | WHO MedNet |
| aprepitantum | WHO MedNet |
| Synonym | Source |
|---|---|
| 3-(((2R,3S)-3-(p-Fluorophenyl)-2-(((αR)-α-methyl-3,5-bis(trifluoromethyl)benzyl)oxy)morpholino)methyl)-Δ2-1,2,4-triazolin-5-one | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 230 | DrugCentral |
| Aprepitant | Wikipedia |
| D02968 | KEGG DRUG |
| DB00673 | DrugBank |
| HMDB0014811 | HMDB |
| LSM-5637 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8096869 | Reaxys |
| CAS:170729-80-3 | KEGG DRUG |
| CAS:170729-80-3 | ChemIDplus |
| CAS:170729-80-3 | DrugBank |
| Citations |
|---|