EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H23NO |
| Net Charge | 0 |
| Average Mass | 245.366 |
| Monoisotopic Mass | 245.17796 |
| SMILES | [H][C@]12CC(=O)[C@@]3([H])CCCN4CCC[C@]13C4=C[C@H](C)C2 |
| InChI | InChI=1S/C16H23NO/c1-11-8-12-10-14(18)13-4-2-6-17-7-3-5-16(12,13)15(17)9-11/h9,11-13H,2-8,10H2,1H3/t11-,12+,13-,16+/m1/s1 |
| InChIKey | ANHVSCXCALAIQN-IATRGZMQSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fawcettidine (CHEBI:4988) is a alkaloid (CHEBI:22315) |
| Synonym | Source |
|---|---|
| Fawcettidine | KEGG COMPOUND |