EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H39N7O3 |
| Net Charge | 0 |
| Average Mass | 521.666 |
| Monoisotopic Mass | 521.31144 |
| SMILES | CC[C@@H]1C(=O)N(C)c2cnc(Nc3ccc(C(=O)NC4CCN(C)CC4)cc3OC)nc2N1C1CCCC1 |
| InChI | InChI=1S/C28H39N7O3/c1-5-22-27(37)34(3)23-17-29-28(32-25(23)35(22)20-8-6-7-9-20)31-21-11-10-18(16-24(21)38-4)26(36)30-19-12-14-33(2)15-13-19/h10-11,16-17,19-20,22H,5-9,12-15H2,1-4H3,(H,30,36)(H,29,31,32)/t22-/m1/s1 |
| InChIKey | XQVVPGYIWAGRNI-JOCHJYFZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. EC 2.7.11.21 (polo kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of any polo kinase (EC 2.7.11.21). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| BI-2536 (CHEBI:49868) has role antineoplastic agent (CHEBI:35610) |
| BI-2536 (CHEBI:49868) has role apoptosis inducer (CHEBI:68495) |
| BI-2536 (CHEBI:49868) has role EC 2.7.11.21 (polo kinase) inhibitor (CHEBI:145425) |
| BI-2536 (CHEBI:49868) is a benzamides (CHEBI:22702) |
| BI-2536 (CHEBI:49868) is a cyclopentanes (CHEBI:23493) |
| BI-2536 (CHEBI:49868) is a monomethoxybenzene (CHEBI:25235) |
| BI-2536 (CHEBI:49868) is a piperidines (CHEBI:26151) |
| BI-2536 (CHEBI:49868) is a secondary amino compound (CHEBI:50995) |
| BI-2536 (CHEBI:49868) is a secondary carboxamide (CHEBI:140325) |
| BI-2536 (CHEBI:49868) is a substituted aniline (CHEBI:48975) |
| BI-2536 (CHEBI:49868) is a tertiary amino compound (CHEBI:50996) |
| BI-2536 (CHEBI:49868) is a tetrahydropterin (CHEBI:30436) |
| IUPAC Name |
|---|
| 4-{[(7R)-8-cyclopentyl-7-ethyl-5-methyl-6-oxo-5,6,7,8-tetrahydropteridin-2-yl]amino}-3-methoxy-N-(1-methylpiperidin-4-yl)benzamide |
| Synonyms | Source |
|---|---|
| 4-[[(7R)-8-cyclopentyl-7-ethyl-5,6,7,8-tetrahydro-5-methyl-6-oxo-2-pteridinyl]amino]-3-methoxy-N-(1-methyl-4-piperidinyl)benzamide | ChEBI |
| BI 2536 | ChEBI |
| BI2536 | ChEBI |
| (R)-4-[(8-cyclopentyl-7-ethyl-5,6,7,8-tetrahydro-5-methyl-6-oxo-2-pteridinyl)amino]-3-methoxy-N-(1-methyl-4-piperidinyl)benzamide | ChEBI |
| Citations |
|---|