EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H15N3O2 |
| Net Charge | 0 |
| Average Mass | 269.304 |
| Monoisotopic Mass | 269.11643 |
| SMILES | CN(C)c1ccc(/N=N/c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C15H15N3O2/c1-18(2)12-9-7-11(8-10-12)16-17-14-6-4-3-5-13(14)15(19)20/h3-10H,1-2H3,(H,19,20)/b17-16+ |
| InChIKey | CEQFOVLGLXCDCX-WUKNDPDISA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl red (CHEBI:49770) has role dye (CHEBI:37958) |
| methyl red (CHEBI:49770) is a azobenzenes (CHEBI:22682) |
| methyl red (CHEBI:49770) is a monocarboxylic acid (CHEBI:25384) |
| methyl red (CHEBI:49770) is a tertiary amino compound (CHEBI:50996) |
| methyl red (CHEBI:49770) is conjugate acid of methyl red(1−) (CHEBI:71579) |
| Incoming Relation(s) |
| methyl red(1−) (CHEBI:71579) is conjugate base of methyl red (CHEBI:49770) |
| IUPAC Name |
|---|
| 2-{[4-(dimethylamino)phenyl]diazenyl}benzoic acid |
| Synonyms | Source |
|---|---|
| 2-((4-Dimethylamino)phenylazo)benzoic acid | ChemIDplus |
| 2-Carboxy-4'-(dimethylamino)azobenzene | ChemIDplus |
| 2-[(p-Dimethylamino)phenyl]azobenzoic acid | NIST Chemistry WebBook |
| 4-Dimethylamino-2'-carboxylazobenzene | ChemIDplus |
| 4'-(Dimethylamino)azobenzene-2-carboxylic acid | NIST Chemistry WebBook |
| 4'-Dimethylaminoazobenzene-2-carboxylic acid | ChemIDplus |
| Citations |
|---|