EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H15N7O2S3 |
| Net Charge | 0 |
| Average Mass | 337.456 |
| Monoisotopic Mass | 337.04494 |
| SMILES | NC(N)=Nc1nc(CSCCC(N)=NS(N)(=O)=O)cs1 |
| InChI | InChI=1S/C8H15N7O2S3/c9-6(15-20(12,16)17)1-2-18-3-5-4-19-8(13-5)14-7(10)11/h4H,1-3H2,(H2,9,15)(H2,12,16,17)(H4,10,11,13,14) |
| InChIKey | XUFQPHANEAPEMJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | H2-receptor antagonist H2-receptor antagonists are the drugs that selectively bind to but do not activate histamine H2 receptors, thereby blocking the actions of endogenous histamine. P450 inhibitor An enzyme inhibitor that interferes with the activity of cytochrome P450 involved in catalysis of organic substances. |
| Applications: | H2-receptor antagonist H2-receptor antagonists are the drugs that selectively bind to but do not activate histamine H2 receptors, thereby blocking the actions of endogenous histamine. anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| famotidine (CHEBI:4975) has role anti-ulcer drug (CHEBI:49201) |
| famotidine (CHEBI:4975) has role H2-receptor antagonist (CHEBI:37961) |
| famotidine (CHEBI:4975) has role P450 inhibitor (CHEBI:50183) |
| famotidine (CHEBI:4975) is a 1,3-thiazoles (CHEBI:38418) |
| famotidine (CHEBI:4975) is a guanidines (CHEBI:24436) |
| famotidine (CHEBI:4975) is a sulfonamide (CHEBI:35358) |
| Incoming Relation(s) |
| famotidine hydrochloride (CHEBI:50377) has part famotidine (CHEBI:4975) |
| IUPAC Name |
|---|
| N'-(aminosulfonyl)-3-[({2-[(diaminomethylidene)amino]-1,3-thiazol-4-yl}methyl)sulfanyl]propanimidamide |
| INNs | Source |
|---|---|
| famotidina | ChemIDplus |
| famotidine | ChemIDplus |
| famotidinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (1-Amino-3-(((2-((diaminomethylene)amino)-4-thiazolyl)methyl)thio)propylidene)sulfamide | ChemIDplus |
| 3-(((2-((Aminoiminomethyl)amino)-4-thiazolyl)methyl)thio)-N-(aminosulfonyl)propanimidamide | ChemIDplus |
| 3-(((2-((Diaminomethylene)amino)-4-thiazolyl)methyl)thio)-N(sup 2)-sulfamoylpropionamidine | ChemIDplus |
| N-Sulfamoyl-3-((2-guanidinothiazol-4-yl)methylthio)propionamide | ChemIDplus |
| Brand Name | Source |
|---|---|
| Pepcid | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| 1129 | DrugCentral |
| D00318 | KEGG DRUG |
| DB00927 | DrugBank |
| Famotidine | Wikipedia |
| LSM-5201 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5767271 | Beilstein |
| CAS:76824-35-6 | KEGG DRUG |
| CAS:76824-35-6 | ChemIDplus |