EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:4975 - famotidine
| Formula | C8H15N7O2S3 |
| Net Charge | 0 |
| Average Mass | 337.456 |
| Monoisotopic Mass | 337.04494 |
| SMILES | NC(N)=Nc1nc(CSCCC(N)=NS(N)(=O)=O)cs1 |
| InChI | InChI=1S/C8H15N7O2S3/c9-6(15-20(12,16)17)1-2-18-3-5-4-19-8(13-5)14-7(10)11/h4H,1-3H2,(H2,9,15)(H2,12,16,17)(H4,10,11,13,14) |
| InChIKey | XUFQPHANEAPEMJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | P450 inhibitor An enzyme inhibitor that interferes with the activity of cytochrome P450 involved in catalysis of organic substances. H2-receptor antagonist H2-receptor antagonists are the drugs that selectively bind to but do not activate histamine H2 receptors, thereby blocking the actions of endogenous histamine. |
| Applications: | anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. H2-receptor antagonist H2-receptor antagonists are the drugs that selectively bind to but do not activate histamine H2 receptors, thereby blocking the actions of endogenous histamine. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| famotidine (CHEBI:4975) has role anti-ulcer drug (CHEBI:49201) |
| famotidine (CHEBI:4975) has role H2-receptor antagonist (CHEBI:37961) |
| famotidine (CHEBI:4975) has role P450 inhibitor (CHEBI:50183) |
| famotidine (CHEBI:4975) is a 1,3-thiazoles (CHEBI:38418) |
| famotidine (CHEBI:4975) is a guanidines (CHEBI:24436) |
| famotidine (CHEBI:4975) is a sulfonamide (CHEBI:35358) |
| Incoming Relation(s) |
| famotidine hydrochloride (CHEBI:50377) has part famotidine (CHEBI:4975) |
| IUPAC Name |
|---|
| N'-(aminosulfonyl)-3-[({2-[(diaminomethylidene)amino]-1,3-thiazol-4-yl}methyl)sulfanyl]propanimidamide |
| INNs | Source |
|---|---|
| famotidina | ChemIDplus |
| famotidine | ChemIDplus |
| famotidinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (1-Amino-3-(((2-((diaminomethylene)amino)-4-thiazolyl)methyl)thio)propylidene)sulfamide | ChemIDplus |
| 3-(((2-((Aminoiminomethyl)amino)-4-thiazolyl)methyl)thio)-N-(aminosulfonyl)propanimidamide | ChemIDplus |
| 3-(((2-((Diaminomethylene)amino)-4-thiazolyl)methyl)thio)-N(sup 2)-sulfamoylpropionamidine | ChemIDplus |
| N-Sulfamoyl-3-((2-guanidinothiazol-4-yl)methylthio)propionamide | ChemIDplus |
| Brand Name | Source |
|---|---|
| Pepcid | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| 1129 | DrugCentral |
| D00318 | KEGG DRUG |
| DB00927 | DrugBank |
| Famotidine | Wikipedia |
| LSM-5201 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5767271 | Beilstein |
| CAS:76824-35-6 | KEGG DRUG |
| CAS:76824-35-6 | ChemIDplus |