EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H19N5O4 |
| Net Charge | 0 |
| Average Mass | 321.337 |
| Monoisotopic Mass | 321.14370 |
| SMILES | CC(=O)OCC(CCn1cnc2cnc(N)nc21)COC(C)=O |
| InChI | InChI=1S/C14H19N5O4/c1-9(20)22-6-11(7-23-10(2)21)3-4-19-8-17-12-5-16-14(15)18-13(12)19/h5,8,11H,3-4,6-7H2,1-2H3,(H2,15,16,18) |
| InChIKey | GGXKWVWZWMLJEH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. antiviral agent A substance that destroys or inhibits replication of viruses. immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. anti-HSV agent An antiviral agent that destroys or inhibits the replication of the herpes simplex virus (also known as the human herpes virus). |
| Applications: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| famciclovir (CHEBI:4974) has role anti-HSV agent (CHEBI:64952) |
| famciclovir (CHEBI:4974) has role antiviral agent (CHEBI:22587) |
| famciclovir (CHEBI:4974) has role antiviral drug (CHEBI:36044) |
| famciclovir (CHEBI:4974) has role immunosuppressive agent (CHEBI:35705) |
| famciclovir (CHEBI:4974) has role ophthalmology drug (CHEBI:66981) |
| famciclovir (CHEBI:4974) has role prodrug (CHEBI:50266) |
| famciclovir (CHEBI:4974) is a 2-aminopurines (CHEBI:20702) |
| famciclovir (CHEBI:4974) is a acetate ester (CHEBI:47622) |
| IUPAC Name |
|---|
| 2-[(acetyloxy)methyl]-4-(2-amino-9H-purin-9-yl)butyl acetate |
| INNs | Source |
|---|---|
| famciclovir | WHO MedNet |
| famciclovir | WHO MedNet |
| famciclovir | ChemIDplus |
| famciclovirum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-(2-(2-amino-9H-purin-9-yl)ethyl)-1,3-propanediol diacetate | ChemIDplus |
| 9-[4-acetoxy-3-(acetoxymethyl)but-1-yl]-2-aminopurine | ChEBI |
| acetic acid 2-acetoxymethyl-4-(2-amino-purin-9-yl)-butyl ester | ChEMBL |
| BRL-42810 | ChEMBL |
| FAMCICLOVIR | ChEMBL |
| FCV | DrugBank |
| Brand Name | Source |
|---|---|
| Famvir | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 1128 | DrugCentral |
| D00317 | KEGG DRUG |
| DB00426 | DrugBank |
| Famciclovir | Wikipedia |
| HMDB0014570 | HMDB |
| LSM-2990 | LINCS |
| US5246937 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4208403 | Reaxys |
| CAS:104227-87-4 | ChemIDplus |
| CAS:104227-87-4 | KEGG DRUG |
| Citations |
|---|