EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H19N5O4 |
| Net Charge | 0 |
| Average Mass | 321.337 |
| Monoisotopic Mass | 321.14370 |
| SMILES | CC(=O)OCC(CCn1cnc2cnc(N)nc21)COC(C)=O |
| InChI | InChI=1S/C14H19N5O4/c1-9(20)22-6-11(7-23-10(2)21)3-4-19-8-17-12-5-16-14(15)18-13(12)19/h5,8,11H,3-4,6-7H2,1-2H3,(H2,15,16,18) |
| InChIKey | GGXKWVWZWMLJEH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| Applications: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| famciclovir (CHEBI:4974) has role antiviral drug (CHEBI:36044) |
| famciclovir (CHEBI:4974) has role prodrug (CHEBI:50266) |
| famciclovir (CHEBI:4974) is a 2-aminopurines (CHEBI:20702) |
| famciclovir (CHEBI:4974) is a acetate ester (CHEBI:47622) |
| IUPAC Name |
|---|
| 2-[(acetyloxy)methyl]-4-(2-amino-9H-purin-9-yl)butyl acetate |
| INNs | Source |
|---|---|
| famciclovir | WHO MedNet |
| famciclovir | WHO MedNet |
| famciclovir | ChemIDplus |
| famciclovirum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-(2-(2-amino-9H-purin-9-yl)ethyl)-1,3-propanediol diacetate | ChemIDplus |
| 9-[4-acetoxy-3-(acetoxymethyl)but-1-yl]-2-aminopurine | ChEBI |
| acetic acid 2-acetoxymethyl-4-(2-amino-purin-9-yl)-butyl ester | ChEMBL |
| BRL-42810 | ChEMBL |
| FAMCICLOVIR | ChEMBL |
| FCV | DrugBank |
| Brand Name | Source |
|---|---|
| Famvir | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 1128 | DrugCentral |
| D00317 | KEGG DRUG |
| DB00426 | DrugBank |
| Famciclovir | Wikipedia |
| HMDB0014570 | HMDB |
| LSM-2990 | LINCS |
| US5246937 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4208403 | Reaxys |
| CAS:104227-87-4 | KEGG DRUG |
| CAS:104227-87-4 | ChemIDplus |
| Citations |
|---|