EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H47NO10 |
| Net Charge | 0 |
| Average Mass | 629.747 |
| Monoisotopic Mass | 629.32000 |
| SMILES | [H][C@]12C[C@]3(O)[C@@H](OC)C=C([C@@H]4C5N(CC)C[C@]6(COC)[C@H](O)C[C@H](OC)[C@@]51[C@]6([H])[C@H]4OC)[C@@]2([H])[C@H]3OC(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C34H47NO10/c1-8-35-15-32(16-39-2)22(36)13-24(43-6)34-19-14-33(38)23(42-5)12-18(26(29(34)35)27(44-7)28(32)34)25(19)30(33)45-31(37)17-9-10-20(40-3)21(11-17)41-4/h9-12,19,22-30,36,38H,8,13-16H2,1-7H3/t19-,22-,23+,24+,25-,26+,27+,28-,29?,30-,32+,33+,34+/m1/s1 |
| InChIKey | AWCSAXLOUNZFKK-TUCMIPCLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Falaconitine (CHEBI:4970) is a methoxybenzoic acid (CHEBI:25238) |
| Synonym | Source |
|---|---|
| Falaconitine | KEGG COMPOUND |