EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H2Br4N2 |
| Net Charge | 0 |
| Average Mass | 433.723 |
| Monoisotopic Mass | 429.69515 |
| SMILES | Brc1c(Br)c(Br)c2ncnc2c1Br |
| InChI | InChI=1S/C7H2Br4N2/c8-2-3(9)5(11)7-6(4(2)10)12-1-13-7/h1H,(H,12,13) |
| InChIKey | LOEIRDBRYBHAJB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of non-specific serine/threonine protein kinase (EC 2.7.11.1), a kinase enzyme involved in phosphorylation of hydroxy group of serine or threonine. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,5,6,7-tetrabromobenzimidazole (CHEBI:49681) has role apoptosis inducer (CHEBI:68495) |
| 4,5,6,7-tetrabromobenzimidazole (CHEBI:49681) has role EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor (CHEBI:50925) |
| 4,5,6,7-tetrabromobenzimidazole (CHEBI:49681) is a benzimidazoles (CHEBI:22715) |
| 4,5,6,7-tetrabromobenzimidazole (CHEBI:49681) is a organobromine compound (CHEBI:37141) |
| IUPAC Name |
|---|
| 4,5,6,7-tetrabromo-1H-benzimidazole |
| Synonyms | Source |
|---|---|
| 4,5,6,7-1H-tetrabromobenzimidazole | ChEBI |
| 4,5,6,7-tetrabromo-1H-1,3-benzodiazole | ChEBI |
| 4,5,6,7-tetrabromo-benzimidazole | PDBeChem |
| casein kinase II inhibitor XII | ChEBI |
| TBBz | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| K17 | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| CAS:577779-57-8 | ChEBI |
| Citations |
|---|