EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H24ClFN4O3 |
| Net Charge | 0 |
| Average Mass | 446.910 |
| Monoisotopic Mass | 446.15210 |
| SMILES | COc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C22H24ClFN4O3/c1-29-20-13-19-16(12-21(20)31-8-2-5-28-6-9-30-10-7-28)22(26-14-25-19)27-15-3-4-18(24)17(23)11-15/h3-4,11-14H,2,5-10H2,1H3,(H,25,26,27) |
| InChIKey | XGALLCVXEZPNRQ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | epidermal growth factor receptor antagonist An antagonist at the epidermal growth factor receptor. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gefitinib (CHEBI:49668) has role antineoplastic agent (CHEBI:35610) |
| gefitinib (CHEBI:49668) has role epidermal growth factor receptor antagonist (CHEBI:74440) |
| gefitinib (CHEBI:49668) is a aromatic ether (CHEBI:35618) |
| gefitinib (CHEBI:49668) is a monochlorobenzenes (CHEBI:83403) |
| gefitinib (CHEBI:49668) is a monofluorobenzenes (CHEBI:83575) |
| gefitinib (CHEBI:49668) is a morpholines (CHEBI:38785) |
| gefitinib (CHEBI:49668) is a quinazolines (CHEBI:38530) |
| gefitinib (CHEBI:49668) is a secondary amino compound (CHEBI:50995) |
| gefitinib (CHEBI:49668) is a tertiary amino compound (CHEBI:50996) |
| Incoming Relation(s) |
| linkable gefitinib analogue (CHEBI:39084) has functional parent gefitinib (CHEBI:49668) |
| IUPAC Name |
|---|
| N-(3-chloro-4-fluorophenyl)-7-methoxy-6-(3-morpholin-4-ylpropoxy)quinazolin-4-amine |
| INNs | Source |
|---|---|
| gefitinib | WHO MedNet |
| gefitinib | WHO MedNet |
| géfitinib | WHO MedNet |
| gefitinibum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 4-(3'-chloro-4'-fluoroanilino)-7-methoxy-6-(3-morpholinopropoxy)quinazoline | ChemIDplus |
| N-(3-chloro-4-fluorophenyl)-7-methoxy-6-(3-(4-morpholinyl)propoxy)-4-quinazolinamine | ChemIDplus |
| ZD 1839 | ChemIDplus |
| ZD-1839 | DrugBank |
| ZD1839 | DrugCentral |
| Brand Names | Source |
|---|---|
| Iressa | ChemIDplus |
| Irressat | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8949523 | Reaxys |
| CAS:184475-35-2 | ChemIDplus |
| Citations |
|---|