EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | CC(C)=C1C/C=C(/C)CC/C=C(/C)CC1 |
| InChI | InChI=1S/C15H24/c1-12(2)15-10-8-13(3)6-5-7-14(4)9-11-15/h6,9H,5,7-8,10-11H2,1-4H3/b13-6-,14-9- |
| InChIKey | GXEGJTGWYVZSNR-OMQMMEOVSA-N |
| Roles Classification |
|---|
| Biological Roles: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1Z,4Z)-germacrene B (CHEBI:49655) is a germacrene B (CHEBI:49314) |
| IUPAC Names |
|---|
| (1Z,4Z)-germacra-1(10),4,7(11)-triene |
| (1Z,5Z)-1,5-dimethyl-8-(propan-2-ylidene)cyclodeca-1,5-diene |
| Synonym | Source |
|---|---|
| (1Z,5Z)-8-isopropylidene-1,5-dimethylcyclodeca-1,5-diene | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2554531 | Beilstein |