EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10ClNO2 |
| Net Charge | 0 |
| Average Mass | 199.637 |
| Monoisotopic Mass | 199.04001 |
| SMILES | N[C@@H](Cc1cccc(Cl)c1)C(=O)O |
| InChI | InChI=1S/C9H10ClNO2/c10-7-3-1-2-6(4-7)5-8(11)9(12)13/h1-4,8H,5,11H2,(H,12,13)/t8-/m0/s1 |
| InChIKey | JJDJLFDGCUYZMN-QMMMGPOBSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-chloro-L-phenylalanine (CHEBI:49597) is a L-phenylalanine derivative (CHEBI:84144) |
| 3-chloro-L-phenylalanine (CHEBI:49597) is a chloroamino acid (CHEBI:23129) |
| 3-chloro-L-phenylalanine (CHEBI:49597) is a monochlorobenzenes (CHEBI:83403) |
| 3-chloro-L-phenylalanine (CHEBI:49597) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| IUPAC Name |
|---|
| (2S)-2-amino-3-(3-chlorophenyl)propanoic acid |
| Synonym | Source |
|---|---|
| 3-CHLORO-L-PHENYLALANINE | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| FCL | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5523927 | Beilstein |