EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13N5O12P3 |
| Net Charge | -3 |
| Average Mass | 488.159 |
| Monoisotopic Mass | 487.97900 |
| SMILES | Nc1ncnc2c1ncn2[C@H]1C[C@H](O)[C@@H](COP(=O)([O-])OP(=O)([O-])OP(=O)([O-])O)O1 |
| InChI | InChI=1S/C10H16N5O12P3/c11-9-8-10(13-3-12-9)15(4-14-8)7-1-5(16)6(25-7)2-24-29(20,21)27-30(22,23)26-28(17,18)19/h3-7,16H,1-2H2,(H,20,21)(H,22,23)(H2,11,12,13)(H2,17,18,19)/p-3/t5-,6+,7+/m0/s1 |
| InChIKey | SUYVUBYJARFZHO-RRKCRQDMSA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dATP(3−) (CHEBI:495505) is a 2'-deoxyribonucleoside triphosphate oxoanion (CHEBI:61662) |
| dATP(3−) (CHEBI:495505) is conjugate acid of dATP(4−) (CHEBI:61404) |
| dATP(3−) (CHEBI:495505) is conjugate base of dATP (CHEBI:16284) |
| Incoming Relation(s) |
| dATP (CHEBI:16284) is conjugate acid of dATP(3−) (CHEBI:495505) |
| dATP(4−) (CHEBI:61404) is conjugate base of dATP(3−) (CHEBI:495505) |
| IUPAC Name |
|---|
| 2'-deoxy-5'-O-[({[(hydroxyphosphinato)oxy]phosphinato}oxy)phosphinato]adenosine |
| Synonym | Source |
|---|---|
| dATP trianion | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Gmelin:2691379 | Gmelin |