EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24O2 |
| Net Charge | 0 |
| Average Mass | 296.410 |
| Monoisotopic Mass | 296.17763 |
| SMILES | [H][C@@]12CC(=C)C3=CC(=O)C=C[C@]3(C)[C@@]1([H])CC[C@]1(C)C(=O)CC[C@@]21[H] |
| InChI | InChI=1S/C20H24O2/c1-12-10-14-15-4-5-18(22)20(15,3)9-7-16(14)19(2)8-6-13(21)11-17(12)19/h6,8,11,14-16H,1,4-5,7,9-10H2,2-3H3/t14-,15-,16-,19+,20-/m0/s1 |
| InChIKey | BFYIZQONLCFLEV-DAELLWKTSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. EC 1.14.14.14 (aromatase) inhibitor An EC 1.14.14.* (oxidoreductase acting on paired donors, incorporating of 1 atom of oxygen, with reduced flavin or flavoprotein as one donor) inhibitor which interferes with the action of aromatase (EC 1.14.14.14) and so reduces production of estrogenic steroid hormones. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| exemestane (CHEBI:4953) has parent hydride androstane (CHEBI:35509) |
| exemestane (CHEBI:4953) has role antineoplastic agent (CHEBI:35610) |
| exemestane (CHEBI:4953) has role EC 1.14.14.14 (aromatase) inhibitor (CHEBI:50790) |
| exemestane (CHEBI:4953) has role environmental contaminant (CHEBI:78298) |
| exemestane (CHEBI:4953) has role xenobiotic (CHEBI:35703) |
| exemestane (CHEBI:4953) is a 17-oxo steroid (CHEBI:19168) |
| exemestane (CHEBI:4953) is a 3-oxo-Δ1,Δ4-steroid (CHEBI:77166) |
| IUPAC Name |
|---|
| 6-methylideneandrosta-1,4-diene-3,17-dione |
| INNs | Source |
|---|---|
| exemestane | ChemIDplus |
| exemestano | ChemIDplus |
| exemestanum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 6-methyleneandrosta-1,4-diene-3,17-dione | ChemIDplus |
| Exemestane | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 1122 | DrugCentral |
| C08162 | KEGG COMPOUND |
| D00963 | KEGG DRUG |
| DB00990 | DrugBank |
| Exemestane | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6609645 | Reaxys |
| CAS:107868-30-4 | KEGG COMPOUND |
| CAS:107868-30-4 | ChemIDplus |
| Citations |
|---|