EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H23BrO2 |
| Net Charge | 0 |
| Average Mass | 279.218 |
| Monoisotopic Mass | 278.08814 |
| SMILES | O=C(O)CCCCCCCCCCCBr |
| InChI | InChI=1S/C12H23BrO2/c13-11-9-7-5-3-1-2-4-6-8-10-12(14)15/h1-11H2,(H,14,15) |
| InChIKey | YYKBWYBUCFHYPR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12-bromododecanoic acid (CHEBI:49519) has functional parent dodecanoic acid (CHEBI:30805) |
| 12-bromododecanoic acid (CHEBI:49519) is a bromo fatty acid (CHEBI:61709) |
| IUPAC Name |
|---|
| 12-bromododecanoic acid |
| Synonyms | Source |
|---|---|
| 12-Br 12:0 | ChEBI |
| 12-Brom-dodecansäure | ChEBI |
| 12-bromo-1-dodecanoic acid | ChEBI |
| 12-bromolauric acid | ChEBI |
| C12-Br 12:0 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| BRC | PDBeChem |
| DB02405 | DrugBank |
| LMFA01090007 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1530040 | Gmelin |
| Reaxys:1771588 | Reaxys |
| Beilstein:1771588 | Beilstein |
| CAS:73367-80-3 | ChemIDplus |
| Citations |
|---|