EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18ClF3N2O5S |
| Net Charge | 0 |
| Average Mass | 478.876 |
| Monoisotopic Mass | 478.05771 |
| SMILES | CN(C)C(=O)c1ccc(S(=O)(=O)c2ccc(NC(=O)[C@@](C)(O)C(F)(F)F)c(Cl)c2)cc1 |
| InChI | InChI=1S/C19H18ClF3N2O5S/c1-18(28,19(21,22)23)17(27)24-15-9-8-13(10-14(15)20)31(29,30)12-6-4-11(5-7-12)16(26)25(2)3/h4-10,28H,1-3H3,(H,24,27)/t18-/m1/s1 |
| InChIKey | DTDZLJHKVNTQGZ-GOSISDBHSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 2.7.11.2 - [pyruvate dehydrogenase (acetyl-transferring)] kinase inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of pyruvate dehydrogenase (acetyl-transferring) kinase (EC 2.7.11.2). |
| Application: | hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| AZD7545 (CHEBI:49490) has role EC 2.7.11.2 - [pyruvate dehydrogenase (acetyl-transferring)] kinase inhibitor (CHEBI:176961) |
| AZD7545 (CHEBI:49490) has role hypoglycemic agent (CHEBI:35526) |
| AZD7545 (CHEBI:49490) is a benzamides (CHEBI:22702) |
| AZD7545 (CHEBI:49490) is a monochlorobenzenes (CHEBI:83403) |
| AZD7545 (CHEBI:49490) is a organofluorine compound (CHEBI:37143) |
| AZD7545 (CHEBI:49490) is a secondary carboxamide (CHEBI:140325) |
| AZD7545 (CHEBI:49490) is a sulfone (CHEBI:35850) |
| AZD7545 (CHEBI:49490) is a tertiary alcohol (CHEBI:26878) |
| AZD7545 (CHEBI:49490) is a tertiary carboxamide (CHEBI:140326) |
| IUPAC Name |
|---|
| 4-[(3-chloro-4-{[(2R)-3,3,3-trifluoro-2-hydroxy-2-methylpropanoyl]amino}phenyl)sulfonyl]-N,N-dimethylbenzamide |
| Synonyms | Source |
|---|---|
| AZD-7545 | ChEBI |
| AZD 7545 | ChEBI |
| 4-(3-chloro-4-{[(2R)-3,3,3-trifluoro-2-hydroxy-2-methylpropanoyl]amino}benzene-1-sulfonyl)-N,N-dimethylbenzamide | IUPAC |
| (R)-4-(3-chloro-4-(3,3,3-trifluoro-2-hydroxy-2-methylpropanamido)phenylsulfonyl)-N,N-dimethylbenzamide | ChEBI |
| Citations |
|---|