EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H11NS3 |
| Net Charge | 0 |
| Average Mass | 181.351 |
| Monoisotopic Mass | 181.00536 |
| SMILES | CN(C)C1CSSSC1 |
| InChI | InChI=1S/C5H11NS3/c1-6(2)5-3-7-9-8-4-5/h5H,3-4H2,1-2H3 |
| InChIKey | DNVLJEWNNDHELH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thiocyclam (CHEBI:4947) has parent hydride 1,2,3-trithiane (CHEBI:39194) |
| thiocyclam (CHEBI:4947) has role agrochemical (CHEBI:33286) |
| thiocyclam (CHEBI:4947) has role nicotinic acetylcholine receptor agonist (CHEBI:47958) |
| thiocyclam (CHEBI:4947) is a nereistoxin analogue insecticide (CHEBI:39191) |
| thiocyclam (CHEBI:4947) is a organosulfur heterocyclic compound (CHEBI:38106) |
| thiocyclam (CHEBI:4947) is conjugate base of thiocyclam(1+) (CHEBI:133552) |
| Incoming Relation(s) |
| thiocyclam(1+) (CHEBI:133552) is conjugate acid of thiocyclam (CHEBI:4947) |
| IUPAC Name |
|---|
| N,N-dimethyl-1,2,3-trithian-5-amine |
| Synonyms | Source |
|---|---|
| Thiocyclam | KEGG COMPOUND |
| 5-(dimethylamino)-1,2,3-trithiane | ChemIDplus |
| N,N-dimethyl-1,2,3-trithian-5-ylamine | ChemIDplus |
| thiocyclame | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C11473 | KEGG COMPOUND |
| thiocyclam | Alan Wood's Pesticides |
| 1065 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4738857 | Reaxys |
| CAS:31895-21-3 | KEGG COMPOUND |
| CAS:31895-21-3 | ChemIDplus |
| CAS:31895-21-3 | Alan Wood's Pesticides |
| CAS:31895-21-3 | NIST Chemistry WebBook |
| Citations |
|---|