EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H8O4 |
| Net Charge | 0 |
| Average Mass | 228.203 |
| Monoisotopic Mass | 228.04226 |
| SMILES | O=c1c2cc(O)ccc2oc2cccc(O)c12 |
| InChI | InChI=1S/C13H8O4/c14-7-4-5-10-8(6-7)13(16)12-9(15)2-1-3-11(12)17-10/h1-6,14-15H |
| InChIKey | KDXFPEKLLFWHMN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cratoxylum cochinchinense (ncbitaxon:271749) | stem (BTO:0001300) | PubMed (21428375) | Methanolic extract of dried and ground stems |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| euxanthone (CHEBI:4946) has role metabolite (CHEBI:25212) |
| euxanthone (CHEBI:4946) has role plant metabolite (CHEBI:76924) |
| euxanthone (CHEBI:4946) is a phenols (CHEBI:33853) |
| euxanthone (CHEBI:4946) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| 1,7-dihydroxy-9H-xanthen-9-one |
| Synonyms | Source |
|---|---|
| 1,7-Dihydroxyxanthone | KEGG COMPOUND |
| eyxanthone | HMDB |
| purrenone | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C00002949 | KNApSAcK |
| C00029364 | KNApSAcK |
| C10061 | KEGG COMPOUND |
| HMDB0030724 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:207044 | Reaxys |
| CAS:529-61-3 | ChemIDplus |
| CAS:529-61-3 | KEGG COMPOUND |
| Citations |
|---|