EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C50H76O4 |
| Net Charge | 0 |
| Average Mass | 741.154 |
| Monoisotopic Mass | 740.57436 |
| SMILES | CC(/C=C/C=C(C)/C=C/C=C(C)/C=C/[C@H](CCC(C)(C)O)C(C)(C)O)=C\C=C\C=C(C)\C=C\C=C(C)\C=C\C=C(C)\C=C\[C@H](CCC(C)(C)O)C(C)(C)O |
| InChI | InChI=1S/C50H76O4/c1-39(23-17-25-41(3)27-19-29-43(5)31-33-45(49(11,12)53)35-37-47(7,8)51)21-15-16-22-40(2)24-18-26-42(4)28-20-30-44(6)32-34-46(50(13,14)54)36-38-48(9,10)52/h15-34,45-46,51-54H,35-38H2,1-14H3/b16-15+,23-17+,24-18+,27-19+,28-20+,33-31+,34-32+,39-21+,40-22+,41-25+,42-26+,43-29+,44-30+/t45-,46-/m1/s1 |
| InChIKey | UVCQMCCIAHQDAF-RNTVPSGKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Halobacterium salinarum (ncbitaxon:2242) | - | PubMed (24823651) | |
| Haloarcula japonica (ncbitaxon:29282) | - | PubMed (25712483) | |
| Haloarcula marismortui (ncbitaxon:2238) | - | PubMed (25402913) |
| Roles Classification |
|---|
| Biological Roles: | biological pigment An endogenous molecular entity that results in a colour of an organism as the consequence of the selective absorption of light. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bacterioruberin (CHEBI:49388) has role bacterial metabolite (CHEBI:76969) |
| bacterioruberin (CHEBI:49388) has role biological pigment (CHEBI:26130) |
| bacterioruberin (CHEBI:49388) is a C50 carotenoid (CHEBI:87165) |
| bacterioruberin (CHEBI:49388) is a tertiary alcohol (CHEBI:26878) |
| bacterioruberin (CHEBI:49388) is a tetrol (CHEBI:33573) |
| Synonyms | Source |
|---|---|
| (2S,2'S)-2,2'-bis(3-hydroxy-3-methylbutyl)-3,4,3',4'-tetradehydro-1,2,1',2'-tetrahydro-γ,γ-carotene-1,1'-diol | MetaCyc |
| (5S,,6E,8E,10E,12E,14E,16E,18E,20E,22E,24E,26E,28E,30E,32S)-5,32-bis(2-hydroxypropan-2-yl)-2,8,12,16,21,25,29,35-octamethylhexatriaconta-6,8,10,12,14,16,18,20,22,24,26,28,30-tridecaene-2,35-diol | IUPAC |
| UniProt Name | Source |
|---|---|
| bacterioruberin | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5915104 | Reaxys |
| CAS:32719-43-0 | ChemIDplus |
| Citations |
|---|