EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13NO3 |
| Net Charge | 0 |
| Average Mass | 195.218 |
| Monoisotopic Mass | 195.08954 |
| SMILES | COc1ccc(C[C@H](N)C(=O)O)cc1 |
| InChI | InChI=1S/C10H13NO3/c1-14-8-4-2-7(3-5-8)6-9(11)10(12)13/h2-5,9H,6,11H2,1H3,(H,12,13)/t9-/m0/s1 |
| InChIKey | GEYBMYRBIABFTA-VIFPVBQESA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-methyl-L-tyrosine (CHEBI:49336) is a O-methyltyrosine (CHEBI:192376) |
| O-methyl-L-tyrosine (CHEBI:49336) is enantiomer of O-methyl-D-tyrosine (CHEBI:192378) |
| O-methyl-L-tyrosine (CHEBI:49336) is tautomer of O-methyl-L-tyrosine zwitterion (CHEBI:193554) |
| Incoming Relation(s) |
| O-methyl-D-tyrosine (CHEBI:192378) is enantiomer of O-methyl-L-tyrosine (CHEBI:49336) |
| O-methyl-L-tyrosine zwitterion (CHEBI:193554) is tautomer of O-methyl-L-tyrosine (CHEBI:49336) |
| IUPAC Name |
|---|
| O-methyl-L-tyrosine |
| Synonyms | Source |
|---|---|
| (2S)-2-amino-3-(4-methoxyphenyl)propanoic acid | IUPAC |
| 4-methoxy-L-phenylalanine | ChEBI |
| (S)-2-amino-3-(4-methoxyphenyl)propionic acid | ChEBI |
| Citations |
|---|