EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H36O4 |
| Net Charge | 0 |
| Average Mass | 448.603 |
| Monoisotopic Mass | 448.26136 |
| SMILES | [H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])C[C@H]2O[C@@](C)(c3ccccc3)O[C@]21C(C)=O |
| InChI | InChI=1S/C29H36O4/c1-18(30)29-25(32-28(4,33-29)19-8-6-5-7-9-19)17-24-22-11-10-20-16-21(31)12-14-26(20,2)23(22)13-15-27(24,29)3/h5-9,16,22-25H,10-15,17H2,1-4H3/t22-,23+,24+,25-,26+,27+,28-,29-/m1/s1 |
| InChIKey | AHBKIEXBQNRDNL-FVCOMRFXSA-N |
| Roles Classification |
|---|
| Applications: | synthetic oral contraceptive An oral contraceptive which owes its effectiveness to synthetic preparation. anti-inflammatory drug A substance that reduces or suppresses inflammation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| algestone acetophenide (CHEBI:49327) has role anti-inflammatory drug (CHEBI:35472) |
| algestone acetophenide (CHEBI:49327) has role synthetic oral contraceptive (CHEBI:49326) |
| algestone acetophenide (CHEBI:49327) is a 16α,17α-dihydroxyprogesterone acetophenide (CHEBI:34168) |
| IUPAC Name |
|---|
| 16α,17-[(1R)-1-phenylethane-1,1-diyldioxy]pregn-4-ene-3,20-dione |
| Synonym | Source |
|---|---|
| Alphasone acetophenide | ChemIDplus |
| Brand Name | Source |
|---|---|
| Deladroxone | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:24356-94-3 | ChemIDplus |