EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16O7 |
| Net Charge | 0 |
| Average Mass | 344.319 |
| Monoisotopic Mass | 344.08960 |
| SMILES | COc1ccc(-c2cc(=O)c3c(O)c(OC)c(O)cc3o2)cc1OC |
| InChI | InChI=1S/C18H16O7/c1-22-12-5-4-9(6-14(12)23-2)13-7-10(19)16-15(25-13)8-11(20)18(24-3)17(16)21/h4-8,20-21H,1-3H3 |
| InChIKey | DRRWBCNQOKKKOL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Artemisia asiatica (IPNI:179234-1) | - | PubMed (17404061) | |
| Citrus reticulata (IPNI:772038-1) | exocarp (BTO:0000733) | PubMed (7463312) | Previous component: fruit peel; |
| Eupatorium altissimum (IPNI:1076340-2) | whole plant (BTO:0001461) | PubMed (856983) | |
| Merrillia caloxylon (ncbitaxon:159055) | root (BTO:0001188) | DOI (10.1016/0031-9422(74)80328-6) | |
| Orthosiphon stamineus (ncbitaxon:260636) | - | PubMed (4798539) | |
| Otostegia limbata (ncbitaxon:483858) | - | DOI (10.1055/s-0028-1097328) | |
| Salvia lavanduloides (ncbitaxon:392669) | whole plant (BTO:0001461) | Article (REV. LANTINOAM. QUIM., 1974, 5, 41) | |
| Salvia tomentosa (IPNI:457405-1) | leaf (BTO:0000713) | DOI (10.1021/np50003a002) | |
| Sideritis gomeraea (ncbitaxon:155247) | - | Article (J. NAT. PROD., 1978, 41, 279) | |
| Sideritis mugronensis (IPNI:900993-1) | aerial part (BTO:0001658) | DOI (10.1016/S0031-9422(00)89273-0) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor A lipoxygenase inhibitor that interferes with the action of arachidonate 5-lipoxygenase (EC 1.13.11.34). |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| eupatilin (CHEBI:4932) has role anti-inflammatory agent (CHEBI:67079) |
| eupatilin (CHEBI:4932) has role anti-ulcer drug (CHEBI:49201) |
| eupatilin (CHEBI:4932) has role antineoplastic agent (CHEBI:35610) |
| eupatilin (CHEBI:4932) has role EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor (CHEBI:64964) |
| eupatilin (CHEBI:4932) has role metabolite (CHEBI:25212) |
| eupatilin (CHEBI:4932) is a dihydroxyflavone (CHEBI:38686) |
| eupatilin (CHEBI:4932) is a trimethoxyflavone (CHEBI:27124) |
| IUPAC Name |
|---|
| 2-(3,4-dimethoxyphenyl)-5,7-dihydroxy-6-methoxy-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 2-(3,4-dimethoxyphenyl)-5,7-dihydroxy-6-methoxy-4H-1-benzopyran-4-one | ChemIDplus |
| 5,7-dihydroxy-3',4',6-trimethoxyflavone | ChEBI |
| Eupatilin | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1354453 | Reaxys |
| CAS:22368-21-4 | ChemIDplus |
| CAS:22368-21-4 | KEGG COMPOUND |
| Citations |
|---|