EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | [H][C@@]12CC[C@@]3([H])C(=C)[C@]1(C)CCCC(C)(C)[C@@]23[H] |
| InChI | InChI=1S/C15H24/c1-10-11-6-7-12-13(11)14(2,3)8-5-9-15(10,12)4/h11-13H,1,5-9H2,2-4H3/t11-,12-,13+,15-/m0/s1 |
| InChIKey | PDSNLYSELAIEBU-XPCVCDNBSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-longifolene (CHEBI:49286) is a longifolene (CHEBI:6530) |
| (−)-longifolene (CHEBI:49286) is enantiomer of (+)-longifolene (CHEBI:49282) |
| Incoming Relation(s) |
| (+)-longifolene (CHEBI:49282) is enantiomer of (−)-longifolene (CHEBI:49286) |
| IUPAC Name |
|---|
| (1R,3aS,4R,8aR)-4,8,8-trimethyl-9-methylidenedecahydro-1,4-methanoazulene |
| Synonym | Source |
|---|---|
| (1R,3aS,4R,8aR)-4,8,8-trimethyl-9-methylenedecahydro-1,4-methanoazulene | IUPAC |
| UniProt Name | Source |
|---|---|
| (−)-longifolene | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5731712 | Beilstein |
| Beilstein:6592929 | Beilstein |