EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | CC1=C2C=C(C(C)C)CC[C@@]2(C)CCC1 |
| InChI | InChI=1S/C15H24/c1-11(2)13-7-9-15(4)8-5-6-12(3)14(15)10-13/h10-11H,5-9H2,1-4H3/t15-/m1/s1 |
| InChIKey | VEGYMPQCXPVQJY-OAHLLOKOSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-δ-selinene (CHEBI:49279) is a δ-selinene (CHEBI:49278) |
| (+)-δ-selinene (CHEBI:49279) is enantiomer of (−)-δ-selinene (CHEBI:49280) |
| Incoming Relation(s) |
| (−)-δ-selinene (CHEBI:49280) is enantiomer of (+)-δ-selinene (CHEBI:49279) |
| IUPAC Names |
|---|
| eudesma-4,6-diene |
| (8aR)-4,8a-dimethyl-6-(propan-2-yl)-1,2,3,7,8,8a-hexahydronaphthalene |
| Synonym | Source |
|---|---|
| (8aR)-6-isopropyl-4,8a-dimethyl-1,2,3,7,8,8a-hexahydronaphthalene | IUPAC |
| UniProt Name | Source |
|---|---|
| (+)-δ-selinene | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2326947 | Beilstein |
| Beilstein:4382340 | Beilstein |