EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | C=C(C)C1CCC2(C)CCCC(=C)C2C1 |
| InChI | InChI=1S/C15H24/c1-11(2)13-7-9-15(4)8-5-6-12(3)14(15)10-13/h13-14H,1,3,5-10H2,2,4H3 |
| InChIKey | YOVSPTNQHMDJAG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (5ξ,7ξ,10ξ)-eudesma-4(14),11-diene (CHEBI:49271) has role plant metabolite (CHEBI:76924) |
| (5ξ,7ξ,10ξ)-eudesma-4(14),11-diene (CHEBI:49271) is a selinene (CHEBI:49272) |
| Incoming Relation(s) |
| β-selinene (CHEBI:49276) is a (5ξ,7ξ,10ξ)-eudesma-4(14),11-diene (CHEBI:49271) |
| IUPAC Names |
|---|
| (5ξ,7ξ,10ξ)-eudesma-4(14),11-diene |
| 4a-methyl-1-methylidene-7-(prop-1-en-2-yl)decahydronaphthalene |
| Synonym | Source |
|---|---|
| 7-isopropenyl-4a-methyl-1-methylenedecahydronaphthalene | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2044559 | Beilstein |
| CAS:19069-44-4 | NIST Chemistry WebBook |