EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H30O3 |
| Net Charge | 0 |
| Average Mass | 294.435 |
| Monoisotopic Mass | 294.21949 |
| SMILES | CC/C=C\C[C@H]1C(=O)CC[C@H]1CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H30O3/c1-2-3-7-11-16-15(13-14-17(16)19)10-8-5-4-6-9-12-18(20)21/h3,7,15-16H,2,4-6,8-14H2,1H3,(H,20,21)/b7-3-/t15-,16-/m1/s1 |
| InChIKey | BZXZFDKIRZBJEP-GTOOTHNYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-[(1R,2R)-3-oxo-2-{(Z)-pent-2-en-1-yl}cyclopentyl]octanoic acid (CHEBI:49265) is a 8-{3-oxo-2-[(2Z)-pent-2-en-1-yl]cyclopentyl}octanoic acid (CHEBI:191853) |
| 8-[(1R,2R)-3-oxo-2-{(Z)-pent-2-en-1-yl}cyclopentyl]octanoic acid (CHEBI:49265) is conjugate acid of 8-[(1R,2R)-3-oxo-2-{(Z)-pent-2-en-1-yl}cyclopentyl]octanoate (CHEBI:15720) |
| Incoming Relation(s) |
| 8-[(1R,2R)-3-oxo-2-{(Z)-pent-2-en-1-yl}cyclopentyl]octanoate (CHEBI:15720) is conjugate base of 8-[(1R,2R)-3-oxo-2-{(Z)-pent-2-en-1-yl}cyclopentyl]octanoic acid (CHEBI:49265) |
| IUPAC Name |
|---|
| 8-[(1R,2R)-3-oxo-2-{(2Z)-pent-2-en-1-yl}cyclopentyl]octanoic acid |
| Synonyms | Source |
|---|---|
| (1R,2R)-3-oxo-2-(2'Z-pentenyl)-cyclopentaneoctanoic acid | LIPID MAPS |
| (1R,2R)-OPC8 | ChEBI |
| 8-{(1R,2R)-3-oxo-2-[(2Z)-pent-2-en-1-yl]cyclopentyl}octanoic acid | IUPAC |
| 8-[(1R,2R)-3-oxo-2-{(Z)-pent-2-enyl}cyclopentyl]octanoic acid | ChEBI |
| (9R,13R)-10,11-dihydro-12-oxo-15-phytoenoic acid | LIPID MAPS |
| OPC-8:0 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 4653754 | ChemSpider |
| C22503 | KEGG COMPOUND |
| LMFA02010006 | LIPID MAPS |
| Citations |
|---|