EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | [H][C@@]1(C(=C)CCC=C(C)C)CC=C(C)CC1 |
| InChI | InChI=1S/C15H24/c1-12(2)6-5-7-14(4)15-10-8-13(3)9-11-15/h6,8,15H,4-5,7,9-11H2,1-3H3/t15-/m1/s1 |
| InChIKey | XZRVRYFILCSYSP-OAHLLOKOSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-β-bisabolene (CHEBI:49263) is a β-bisabolene (CHEBI:49249) |
| (S)-β-bisabolene (CHEBI:49263) is enantiomer of (R)-β-bisabolene (CHEBI:49266) |
| Incoming Relation(s) |
| (R)-β-bisabolene (CHEBI:49266) is enantiomer of (S)-β-bisabolene (CHEBI:49263) |
| IUPAC Names |
|---|
| (4S)-1-methyl-4-(5-methyl-1-methylenehex-4-en-1-yl)cyclohexene |
| (1S)-bisabola-4,7(11),10(15)-triene |
| Synonyms | Source |
|---|---|
| β-bisabolene | NIST Chemistry WebBook |
| (S)-1-methyl-4-(5-methyl-1-methylene-4-hexenyl)cyclohexene | ChemIDplus |
| (−)-β-bisabolene | NIST Chemistry WebBook |
| l-β-bisabolene | NIST Chemistry WebBook |
| (S)-(−)-6-methyl-2-(4-methyl-3-cyclohexen-1-yl)-1,5-heptadiene | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| (S)-β-bisabolene | UniProt |
| Citations |
|---|