EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H20O |
| Net Charge | 0 |
| Average Mass | 192.302 |
| Monoisotopic Mass | 192.15142 |
| SMILES | C=C1CCCC(C)(C)C1/C=C/C(C)=O |
| InChI | InChI=1S/C13H20O/c1-10-6-5-9-13(3,4)12(10)8-7-11(2)14/h7-8,12H,1,5-6,9H2,2-4H3/b8-7+ |
| InChIKey | SFEOKXHPFMOVRM-BQYQJAHWSA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| γ-ionone (CHEBI:49250) is a ionone (CHEBI:49248) |
| Incoming Relation(s) |
| (−)-γ-ionone (CHEBI:49251) is a γ-ionone (CHEBI:49250) |
| IUPAC Name |
|---|
| (3E)-4-(2,2-dimethyl-6-methylidenecyclohexyl)but-3-en-2-one |
| Synonyms | Source |
|---|---|
| (3E)-4-(2,2-Dimethyl-6-methylenecyclohexyl)-3-buten-2-one | NIST Chemistry WebBook |
| γ-Ionon | ChEBI |