EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | [H][C@@]12C=C(C(C)C)CC[C@@]1(C)CCCC2=C |
| InChI | InChI=1S/C15H24/c1-11(2)13-7-9-15(4)8-5-6-12(3)14(15)10-13/h10-11,14H,3,5-9H2,1-2,4H3/t14-,15+/m0/s1 |
| InChIKey | ALUIZDJKPCNAGJ-LSDHHAIUSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5α,10β-sibirene (CHEBI:49232) is a sibirene (CHEBI:49231) |
| 5α,10β-sibirene (CHEBI:49232) is enantiomer of 5β,10α-sibirene (CHEBI:49233) |
| Incoming Relation(s) |
| 5β,10α-sibirene (CHEBI:49233) is enantiomer of 5α,10β-sibirene (CHEBI:49232) |
| IUPAC Names |
|---|
| (4aR,8aS)-4a-methyl-7-(propan-2-yl)-1-methylidene-1,2,3,4,4a,5,6,8a-octahydronaphthalene |
| eudesma-4(14),6-diene |
| Synonym | Source |
|---|---|
| (4aR,8aS)-7-isopropyl-4a-methyl-1-methylene-1,2,3,4,4a,5,6,8a-octahydronaphthalene | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3046425 | Beilstein |