EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | CC1=CC2C(CC1)C(C)=CCCC2(C)C |
| InChI | InChI=1S/C15H24/c1-11-7-8-13-12(2)6-5-9-15(3,4)14(13)10-11/h6,10,13-14H,5,7-9H2,1-4H3 |
| InChIKey | PUWNTRHCKNHSAT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| γ-himachalene (CHEBI:49224) is a himachalene (CHEBI:49209) |
| Incoming Relation(s) |
| cis-γ-himachalene (CHEBI:49225) is a γ-himachalene (CHEBI:49224) |
| trans-γ-himachalene (CHEBI:49226) is a γ-himachalene (CHEBI:49224) |
| IUPAC Name |
|---|
| 3,5,5,9-tetramethyl-2,4a,5,6,7,9a-hexahydro-1H-benzo[7]annulene |
| UniProt Name | Source |
|---|---|
| γ-himachalene | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4381612 | Beilstein |