EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | [H][C@@]12C=C(C)CC[C@]1([H])C(=C)CCCC2(C)C |
| InChI | InChI=1S/C15H24/c1-11-7-8-13-12(2)6-5-9-15(3,4)14(13)10-11/h10,13-14H,2,5-9H2,1,3-4H3/t13-,14-/m1/s1 |
| InChIKey | ZJSIKVDEOWWVEH-ZIAGYGMSSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1S,6R)-α-himachalene (CHEBI:49219) is a cis-α-himachalene (CHEBI:49216) |
| (1S,6R)-α-himachalene (CHEBI:49219) is enantiomer of (1R,6S)-α-himachalene (CHEBI:49218) |
| Incoming Relation(s) |
| (1R,6S)-α-himachalene (CHEBI:49218) is enantiomer of (1S,6R)-α-himachalene (CHEBI:49219) |
| IUPAC Names |
|---|
| 1β,6β-himachal-4,11-diene |
| (4aR,9aS)-3,5,5-trimethyl-9-methylidene-2,4a,5,6,7,8,9,9a-octahydro-1H-benzo[7]annulene |
| Synonym | Source |
|---|---|
| (4aR,9aS)-3,5,5-trimethyl-9-methylene-2,4a,5,6,7,8,9,9a-octahydro-1H-benzo[7]annulene | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2555875 | Beilstein |
| Beilstein:5733419 | Beilstein |