EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | [H][C@@]12C=C(C)CCC1=C(C)CCCC2(C)C |
| InChI | InChI=1S/C15H24/c1-11-7-8-13-12(2)6-5-9-15(3,4)14(13)10-11/h10,14H,5-9H2,1-4H3/t14-/m1/s1 |
| InChIKey | LCOSCMLXPAQCLQ-CQSZACIVSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-β-himachalene (CHEBI:49213) is a β-himachalene (CHEBI:49210) |
| (S)-β-himachalene (CHEBI:49213) is enantiomer of (R)-β-himachalene (CHEBI:49208) |
| Incoming Relation(s) |
| (R)-β-himachalene (CHEBI:49208) is enantiomer of (S)-β-himachalene (CHEBI:49213) |
| IUPAC Names |
|---|
| (4aS)-3,5,5,9-tetramethyl-2,4a,5,6,7,8-hexahydro-1H-benzo[7]annulene |
| 6β-himachal-1(11),4-diene |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2554926 | Beilstein |
| Beilstein:5731914 | Beilstein |